* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(4-FLUOROBENZYL)-5H-THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| English Synonyms: | 6-(4-FLUOROBENZYL)-5H-THIAZOLO[3,2-A]PYRIMIDIN-5-ONE |
| MDL Number.: | MFCD17013711 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1Cc2cnc3n(c2=O)ccs3)F |
| InChi: | InChI=1S/C13H9FN2OS/c14-11-3-1-9(2-4-11)7-10-8-15-13-16(12(10)17)5-6-18-13/h1-6,8H,7H2 |
| InChiKey: | InChIKey=KADSCQRGDZZWAC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.