* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,7-DIMETHYL-3-PENTYL-7,8-DIHYDROQUINOLINE-2,5(1H,6H)-DIONE |
| English Synonyms: | 7,7-DIMETHYL-3-PENTYL-7,8-DIHYDROQUINOLINE-2,5(1H,6H)-DIONE |
| MDL Number.: | MFCD17013744 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCCc1cc2c([nH]c1=O)CC(CC2=O)(C)C |
| InChi: | InChI=1S/C16H23NO2/c1-4-5-6-7-11-8-12-13(17-15(11)19)9-16(2,3)10-14(12)18/h8H,4-7,9-10H2,1-3H3,(H,17,19) |
| InChiKey: | InChIKey=OJMGJQIVZXWETH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.