* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-((3AR,4R,6R,6AR)-6-(AZIDOMETHYL)-2,2-DIMETHYLTETRAHYDROFURO[3,4-D][1,3]DIOXOL-4-YL)-9H-PURIN-6-AMINE |
| English Synonyms: | 9-((3AR,4R,6R,6AR)-6-(AZIDOMETHYL)-2,2-DIMETHYLTETRAHYDROFURO[3,4-D][1,3]DIOXOL-4-YL)-9H-PURIN-6-AMINE |
| MDL Number.: | MFCD17013767 |
| H bond acceptor: | 11 |
| H bond donor: | 1 |
| Smile: | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)n3cnc4c3ncnc4N)CN=[N+]=[N-])C |
| InChi: | InChI=1S/C13H16N8O3/c1-13(2)23-8-6(3-19-20-15)22-12(9(8)24-13)21-5-18-7-10(14)16-4-17-11(7)21/h4-6,8-9,12H,3H2,1-2H3,(H2,14,16,17)/t6-,8-,9-,12-/m1/s1 |
| InChiKey: | InChIKey=QWAPXRJZRIFMTR-WOUKDFQISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.