* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-3-METHYL-1H-INDAZOLE |
English Synonyms: | 7-CHLORO-3-METHYL-1H-INDAZOLE |
MDL Number.: | MFCD17014908 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1c2cccc(c2[nH]n1)Cl |
InChi: | InChI=1S/C8H7ClN2/c1-5-6-3-2-4-7(9)8(6)11-10-5/h2-4H,1H3,(H,10,11) |
InChiKey: | InChIKey=FHRCFSYJFZVAMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.