* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FERULIC ACID-1,2,3-13C3 |
| CAS: | 1255644-61-1 |
| English Synonyms: | FERULIC ACID-1,2,3-13C3 ; TRANS-4-HYDROXY-3-METHOXYCINNAMIC ACID-13C3 |
| MDL Number.: | MFCD17015264 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CO[13c]1[13cH][13c](ccc1O)/C=C/C(=O)O |
| InChi: | InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+/i6+1,7+1,9+1 |
| InChiKey: | InChIKey=KSEBMYQBYZTDHS-YXBKIRPPSA-N |
|
|
| Melting Point: | 168-172 DEG C(LIT) |
| Comments: | ASSAY METHOD: CP MASS SHIFT: M+3 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 197.13 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.