Molecular Structure:
CCD No.:CCD03286720
LINOLENIC ACID-1-13C
Formula:C18 H30 O2
MolWeight:279.422
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | LINOLENIC ACID-1-13C |
| English Synonyms： | LINOLENIC ACID-1-13C |
| MDL Number.： | MFCD17015266 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | CC/C=C\C/C=C\C/C=C\CCCCCCC[13C](=O)O |
| InChi： | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b4-3-,7-6-,10-9-/i18+1 |
| InChiKey： | InChIKey=DTOSIQBPPRVQHS-JAYTYYOISA-N |
|
|
| Melting Point： | -11 DEG C |
| Boiling Point： | 230-232 DEG C/1 MMHG |
| Density： | DENSITY: 0.917 G/ML AT 25 DEG C |
| Comments： | ASSAY METHOD: CP MASS SHIFT: M+1 WGK: 3 |
| Information： | ISOTOPIC PURITY: 99 ATOM % 13C MW: 279.41 |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
