* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,2-DIPHENYL-1,2,4-TRIAZOLIDINE-3,5-DIONE |
CAS: | 34877-12-8 |
English Synonyms: | 1,2-DIPHENYL-1,2,4-TRIAZOLIDINE-3,5-DIONE ; 1,2,4-TRIAZOLIDINE-3,5-DIONE, 1,2-DIPHENYL- |
MDL Number.: | MFCD17015686 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)n2c(=O)[nH]c(=O)n2c3ccccc3 |
InChi: | InChI=1S/C14H11N3O2/c18-13-15-14(19)17(12-9-5-2-6-10-12)16(13)11-7-3-1-4-8-11/h1-10H,(H,15,18,19) |
InChiKey: | InChIKey=YNALDGIYPCAQOR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.