* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BROMO-6-IODOQUINOLINE |
CAS: | 1245563-17-0 |
English Synonyms: | 8-BROMO-6-IODOQUINOLINE |
MDL Number.: | MFCD17015783 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc2cc(cc(c2nc1)Br)I |
InChi: | InChI=1S/C9H5BrIN/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h1-5H |
InChiKey: | InChIKey=PZFOVNDUVUJBHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.