* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AMINO-1-AZASPIRO[4.5]DECAN-2-ONE |
| CAS: | 1251008-10-2 |
| English Synonyms: | 8-AMINO-1-AZASPIRO[4.5]DECAN-2-ONE ; (5R,8R)-8-AMINO-1-AZASPIRO[4.5]DECAN-2-ONE ; RACEMIC 8-AMINO-1-AZASPIRO[4.5]DECAN-2-ONE |
| MDL Number.: | MFCD17016145 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C1C[C@]2(CC[C@H]1N)CCC(=O)N2 |
| InChi: | InChI=1S/C9H16N2O/c10-7-1-4-9(5-2-7)6-3-8(12)11-9/h7H,1-6,10H2,(H,11,12)/t7-,9- |
| InChiKey: | InChIKey=ZSUJRZJQVMYCTE-XWEPSHTISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.