* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-BENZYL-2,4,9-TRIAZA-SPIRO[5.5]UNDEC-2-EN-3-YLAMINE |
English Synonyms: | 9-BENZYL-2,4,9-TRIAZA-SPIRO[5.5]UNDEC-2-EN-3-YLAMINE |
MDL Number.: | MFCD17016147 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)CN2CCC3(CC2)CNC(=NC3)N |
InChi: | InChI=1S/C15H22N4/c16-14-17-11-15(12-18-14)6-8-19(9-7-15)10-13-4-2-1-3-5-13/h1-5H,6-12H2,(H3,16,17,18) |
InChiKey: | InChIKey=JOKWISGMHDKFOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.