* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX100283-001 |
| English Synonyms: | WUXIAPPTEC WX100283-005 ; WUXIAPPTEC WX100283-001 ; WUXIAPPTEC WX100283-010 |
| MDL Number.: | MFCD17016162 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)OC(=O)NC1CCC2(CC1)CCC(CC2)C(O)=O |
| InChi: | InChI=1S/C17H29NO4/c1-16(2,3)22-15(21)18-13-6-10-17(11-7-13)8-4-12(5-9-17)14(19)20/h12-13H,4-11H2,1-3H3,(H,18,21)(H,19,20) |
| InChiKey: | InChIKey=SOHWGTRYELLVAQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.