* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX100312-001 |
| English Synonyms: | WUXIAPPTEC WX100312-010 ; WUXIAPPTEC WX100312-005 ; WUXIAPPTEC WX100312-001 |
| MDL Number.: | MFCD17016187 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(CC1)NS(=O)(=O)C1=CC=CC=C21 |
| InChi: | InChI=1S/C16H22N2O4S/c1-15(2,3)22-14(19)18-10-8-16(9-11-18)12-6-4-5-7-13(12)23(20,21)17-16/h4-7,17H,8-11H2,1-3H3 |
| InChiKey: | InChIKey=AZFJRODPYPFDQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.