* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105185-001 |
| English Synonyms: | WUXIAPPTEC WX105185-001 ; WUXIAPPTEC WX105185-005 ; WUXIAPPTEC WX105185-010 |
| MDL Number.: | MFCD17016316 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CCC3(CCN(CC3)C(=O)OC(C)(C)C)[C@]1([H])C[C@@H]2N |
| InChi: | InChI=1S/C16H28N2O2/c1-15(2,3)20-14(19)18-8-6-16(7-9-18)5-4-11-12(16)10-13(11)17/h11-13H,4-10,17H2,1-3H3/t11-,12-,13+/m1/s1 |
| InChiKey: | InChIKey=LJFRATIJEJFQDN-UPJWGTAASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.