* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105195-001 |
| English Synonyms: | WUXIAPPTEC WX105195-005 ; WUXIAPPTEC WX105195-010 ; WUXIAPPTEC WX105195-001 |
| MDL Number.: | MFCD17016325 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2(C[C@@H]3C[C@H](CN3C2=O)C(O)=O)CC1 |
| InChi: | InChI=1S/C17H26N2O5/c1-16(2,3)24-15(23)18-6-4-17(5-7-18)9-12-8-11(13(20)21)10-19(12)14(17)22/h11-12H,4-10H2,1-3H3,(H,20,21)/t11-,12+/m1/s1 |
| InChiKey: | InChIKey=JULADWXTUWWCPP-NEPJUHHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.