* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105196-001 |
English Synonyms: | WUXIAPPTEC WX105196-005 ; WUXIAPPTEC WX105196-010 ; WUXIAPPTEC WX105196-001 |
MDL Number.: | MFCD17016326 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2(C[C@@H]3CC(N)CN3C2=O)CC1 |
InChi: | InChI=1S/C16H27N3O3/c1-15(2,3)22-14(21)18-6-4-16(5-7-18)9-12-8-11(17)10-19(12)13(16)20/h11-12H,4-10,17H2,1-3H3/t11?,12-/m0/s1 |
InChiKey: | InChIKey=BKRXIGJVSSUCQV-KIYNQFGBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.