* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105205-001 |
English Synonyms: | WUXIAPPTEC WX105205-005 ; WUXIAPPTEC WX105205-001 ; WUXIAPPTEC WX105205-010 |
MDL Number.: | MFCD17016334 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | ClC1=NC2=C(COCC22CCN(CC2)C(=O)OCC2=CC=CC=C2)C(Cl)=N1 |
InChi: | InChI=1S/C19H19Cl2N3O3/c20-16-14-11-26-12-19(15(14)22-17(21)23-16)6-8-24(9-7-19)18(25)27-10-13-4-2-1-3-5-13/h1-5H,6-12H2 |
InChiKey: | InChIKey=ZTMJIWXDRPBPIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.