* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105212-001 |
| English Synonyms: | WUXIAPPTEC WX105212-001 ; WUXIAPPTEC WX105212-010 ; WUXIAPPTEC WX105212-005 |
| MDL Number.: | MFCD17016340 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(CC1)OCC1C(=O)NN=C21 |
| InChi: | InChI=1S/C17H19N3O4/c21-15-13-11-24-17(14(13)18-19-15)6-8-20(9-7-17)16(22)23-10-12-4-2-1-3-5-12/h1-5,13H,6-11H2,(H,19,21) |
| InChiKey: | InChIKey=MBFWJCDHRRQXSX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.