* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105263-001 |
English Synonyms: | WUXIAPPTEC WX105263-010 ; WUXIAPPTEC WX105263-001 ; WUXIAPPTEC WX105263-005 |
MDL Number.: | MFCD17016369 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC2(C1)CN1C(C2)=NC2=C(CNCC2)C1=O |
InChi: | InChI=1S/C18H26N4O3/c1-17(2,3)25-16(24)21-7-5-18(10-21)8-14-20-13-4-6-19-9-12(13)15(23)22(14)11-18/h19H,4-11H2,1-3H3 |
InChiKey: | InChIKey=JLYYNWHGDGOJKG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.