* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX105284-001 |
English Synonyms: | WUXIAPPTEC WX105284-005 ; WUXIAPPTEC WX105284-001 ; WUXIAPPTEC WX105284-010 |
MDL Number.: | MFCD17016381 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CC(C)(C)OC(=O)N1CCN(CC2(CCN3C(Br)=CN=C23)C1)C(=O)OCC1=CC=CC=C1 |
InChi: | InChI=1S/C23H29BrN4O4/c1-22(2,3)32-21(30)27-12-11-26(20(29)31-14-17-7-5-4-6-8-17)15-23(16-27)9-10-28-18(24)13-25-19(23)28/h4-8,13H,9-12,14-16H2,1-3H3 |
InChiKey: | InChIKey=RLIGBOBRPNORCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.