* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105299-001 |
| English Synonyms: | WUXIAPPTEC WX105299-005 ; WUXIAPPTEC WX105299-010 ; WUXIAPPTEC WX105299-001 |
| MDL Number.: | MFCD17016396 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(CC1)NC(=O)C1=C2N=CN=C1 |
| InChi: | InChI=1S/C18H18N4O3/c23-16-14-10-19-12-20-15(14)18(21-16)6-8-22(9-7-18)17(24)25-11-13-4-2-1-3-5-13/h1-5,10,12H,6-9,11H2,(H,21,23) |
| InChiKey: | InChIKey=QDJLDXRBLIXHKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.