* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105300-001 |
| English Synonyms: | WUXIAPPTEC WX105300-010 ; WUXIAPPTEC WX105300-001 ; WUXIAPPTEC WX105300-005 |
| MDL Number.: | MFCD17016397 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(CC1)NC(=O)C1=C2NN=C1 |
| InChi: | InChI=1S/C17H18N4O3/c22-15-13-10-18-20-14(13)17(19-15)6-8-21(9-7-17)16(23)24-11-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2,(H,18,20)(H,19,22) |
| InChiKey: | InChIKey=XRAWEOLARYHLHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.