* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX105304-001 |
| English Synonyms: | WUXIAPPTEC WX105304-005 ; WUXIAPPTEC WX105304-001 ; WUXIAPPTEC WX105304-010 |
| MDL Number.: | MFCD17016399 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | O=C(OCC1=CC=CC=C1)N1CCC2(CC1)NS(=O)(=O)C1=C2N=CN=C1 |
| InChi: | InChI=1S/C17H18N4O4S/c22-16(25-11-13-4-2-1-3-5-13)21-8-6-17(7-9-21)15-14(10-18-12-19-15)26(23,24)20-17/h1-5,10,12,20H,6-9,11H2 |
| InChiKey: | InChIKey=GVCVFYXPTQOENY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.