* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110077 |
English Synonyms: | WUXIAPPTEC WX110077 |
MDL Number.: | MFCD17016441 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CCOC(=O)C1=NO[C@H]2[C@@H]1CN(C2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H20N2O5/c1-5-18-11(16)10-8-6-15(7-9(8)20-14-10)12(17)19-13(2,3)4/h8-9H,5-7H2,1-4H3/t8-,9+/m0/s1 |
InChiKey: | InChIKey=CMQZHEFVUZNYSY-DTWKUNHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.