* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110200-001 |
| English Synonyms: | WUXIAPPTEC WX110200-010 ; WUXIAPPTEC WX110200-005 ; WUXIAPPTEC WX110200-001 |
| MDL Number.: | MFCD17016453 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CC(NC(=O)OCC3=CC=CC=C3)[C@@]1([H])CN(C2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C19H26N2O4/c1-19(2,3)25-18(23)21-10-14-9-16(15(14)11-21)20-17(22)24-12-13-7-5-4-6-8-13/h4-8,14-16H,9-12H2,1-3H3,(H,20,22)/t14-,15+,16?/m1/s1 |
| InChiKey: | InChIKey=PJNZZICJKLESAZ-YSPPHNQVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.