* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110220-001 |
| English Synonyms: | WUXIAPPTEC WX110220-010 ; WUXIAPPTEC WX110220-001 ; WUXIAPPTEC WX110220-005 |
| MDL Number.: | MFCD17016473 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2N(CCC2(C1)NC(=O)OCC=C)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C23H31N3O6/c1-5-13-30-19(27)24-23-11-12-26(21(29)31-15-17-9-7-6-8-10-17)18(23)14-25(16-23)20(28)32-22(2,3)4/h5-10,18H,1,11-16H2,2-4H3,(H,24,27) |
| InChiKey: | InChIKey=BFLUDPDJTFBDSA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.