* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110228-001 |
| English Synonyms: | WUXIAPPTEC WX110228-005 ; WUXIAPPTEC WX110228-001 ; WUXIAPPTEC WX110228-010 |
| MDL Number.: | MFCD17016481 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCN2C[C@@H](N(C[C@@H]2C1)C(=O)OCC1=CC=CC=C1)C(O)=O |
| InChi: | InChI=1S/C21H29N3O6/c1-21(2,3)30-19(27)23-10-9-22-13-17(18(25)26)24(12-16(22)11-23)20(28)29-14-15-7-5-4-6-8-15/h4-8,16-17H,9-14H2,1-3H3,(H,25,26)/t16-,17+/m0/s1 |
| InChiKey: | InChIKey=NBJHFKFUZRBHQR-DLBZAZTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.