* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110229-001 |
| English Synonyms: | WUXIAPPTEC WX110229-010 ; WUXIAPPTEC WX110229-005 ; WUXIAPPTEC WX110229-001 |
| MDL Number.: | MFCD17016482 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CC[C@H](N1CCN(C2)C(=O)OC(C)(C)C)C(O)=O |
| InChi: | InChI=1S/C13H22N2O4/c1-13(2,3)19-12(18)14-6-7-15-9(8-14)4-5-10(15)11(16)17/h9-10H,4-8H2,1-3H3,(H,16,17)/t9-,10+/m1/s1 |
| InChiKey: | InChIKey=WQAAUBFBFUTZCF-ZJUUUORDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.