* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110233-001 |
| English Synonyms: | WUXIAPPTEC WX110233-010 ; WUXIAPPTEC WX110233-005 ; WUXIAPPTEC WX110233-001 |
| MDL Number.: | MFCD17016486 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCN[C@@H]2CCN(C[C@H]12)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C20H29N3O4/c1-20(2,3)27-19(25)23-12-10-21-16-9-11-22(13-17(16)23)18(24)26-14-15-7-5-4-6-8-15/h4-8,16-17,21H,9-14H2,1-3H3/t16-,17+/m1/s1 |
| InChiKey: | InChIKey=NLOHOPCPAVTOLR-SJORKVTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.