* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110243-001 |
| English Synonyms: | WUXIAPPTEC WX110243-001 ; WUXIAPPTEC WX110243-005 ; WUXIAPPTEC WX110243-010 |
| MDL Number.: | MFCD17016495 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CN(C[C@@]1([H])CC(NC2)C(F)(F)F)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C13H21F3N2O2/c1-12(2,3)20-11(19)18-6-8-4-10(13(14,15)16)17-5-9(8)7-18/h8-10,17H,4-7H2,1-3H3/t8-,9+,10?/m1/s1 |
| InChiKey: | InChIKey=RKQFGWYXLMIJBN-ZDGBYWQASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.