* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110247-001 |
| English Synonyms: | WUXIAPPTEC WX110247-001 ; WUXIAPPTEC WX110247-010 ; WUXIAPPTEC WX110247-005 |
| MDL Number.: | MFCD17016499 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | [H][C@]12CC(C[C@]1([H])CCN(CC2)C(=O)OC(C)(C)C)C(=O)OCC |
| InChi: | InChI=1S/C17H29NO4/c1-5-21-15(19)14-10-12-6-8-18(9-7-13(12)11-14)16(20)22-17(2,3)4/h12-14H,5-11H2,1-4H3/t12-,13-/m0/s1 |
| InChiKey: | InChIKey=QLHBJHYYDNBZHI-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.