* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110256-001 |
| English Synonyms: | WUXIAPPTEC WX110256-010 ; WUXIAPPTEC WX110256-001 ; WUXIAPPTEC WX110256-005 |
| MDL Number.: | MFCD17016508 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12CN[C@]1([H])C(C)(C)CN(C2)C(=O)OC(C)(C)C |
| InChi: | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-7-9-6-14-10(9)13(4,5)8-15/h9-10,14H,6-8H2,1-5H3/t9-,10-/m0/s1 |
| InChiKey: | InChIKey=JHFGTUJMJRBKRC-UWVGGRQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.