* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110259-001 |
| English Synonyms: | WUXIAPPTEC WX110259-010 ; WUXIAPPTEC WX110259-001 ; WUXIAPPTEC WX110259-005 |
| MDL Number.: | MFCD17016511 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C12CN(C1COC2)C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C16H19NO5/c1-2-21-14(18)16-10-17(13(16)9-20-11-16)15(19)22-8-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3 |
| InChiKey: | InChIKey=PNUFFEQXVIKPAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.