* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110262-001 |
English Synonyms: | WUXIAPPTEC WX110262-010 ; WUXIAPPTEC WX110262-001 ; WUXIAPPTEC WX110262-005 |
MDL Number.: | MFCD17016513 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | [H][C@@]12CN(C[C@]1(C)CN2)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-5-8-11(4,7-13)6-12-8/h8,12H,5-7H2,1-4H3/t8-,11+/m1/s1 |
InChiKey: | InChIKey=MAAKDBFEHVWWNI-KCJUWKMLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.