* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110263-001 |
| English Synonyms: | WUXIAPPTEC WX110263-010 ; WUXIAPPTEC WX110263-005 ; WUXIAPPTEC WX110263-001 |
| MDL Number.: | MFCD17016514 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | [H][C@]12CCN(C(=O)OC(C)(C)C)[C@@]1(C)CN2C(=O)OCC1=CC=CC=C1 |
| InChi: | InChI=1S/C19H26N2O4/c1-18(2,3)25-17(23)21-11-10-15-19(21,4)13-20(15)16(22)24-12-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3/t15-,19-/m0/s1 |
| InChiKey: | InChIKey=QSMSSMDAMQTXJD-KXBFYZLASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.