* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110270-001 |
English Synonyms: | WUXIAPPTEC WX110270-001 ; WUXIAPPTEC WX110270-010 ; WUXIAPPTEC WX110270-005 |
MDL Number.: | MFCD17016521 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1CC2NCC2N1C(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H22N2O4/c1-5-18-11(16)9-6-8-10(7-14-8)15(9)12(17)19-13(2,3)4/h8-10,14H,5-7H2,1-4H3 |
InChiKey: | InChIKey=POULZLYKKMLCOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.