* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110273-001 |
| English Synonyms: | WUXIAPPTEC WX110273-010 ; WUXIAPPTEC WX110273-005 ; WUXIAPPTEC WX110273-001 |
| MDL Number.: | MFCD17016524 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | [H][C@]12CCCCN(C(=O)OC(C)(C)C)[C@@]1(C)CN2 |
| InChi: | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-8-6-5-7-10-13(15,4)9-14-10/h10,14H,5-9H2,1-4H3/t10-,13-/m0/s1 |
| InChiKey: | InChIKey=IBGLHXFNYBTXAI-GWCFXTLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.