* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110283-001 |
| English Synonyms: | WUXIAPPTEC WX110283-010 ; WUXIAPPTEC WX110283-005 ; WUXIAPPTEC WX110283-001 |
| MDL Number.: | MFCD17016533 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2NCCOC2(C1)C(F)(F)F |
| InChi: | InChI=1S/C13H21F3N2O3/c1-11(2,3)21-10(19)18-6-4-9-12(8-18,13(14,15)16)20-7-5-17-9/h9,17H,4-8H2,1-3H3 |
| InChiKey: | InChIKey=YOPJYAFKHYZKQZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.