* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110285-001 |
| English Synonyms: | WUXIAPPTEC WX110285-010 ; WUXIAPPTEC WX110285-005 ; WUXIAPPTEC WX110285-001 |
| MDL Number.: | MFCD17016535 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2OCCNC2(C)C1 |
| InChi: | InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)14-7-9-12(4,8-14)13-5-6-16-9/h9,13H,5-8H2,1-4H3 |
| InChiKey: | InChIKey=UEGYEYTVDIIBCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.