* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110287-001 |
| English Synonyms: | WUXIAPPTEC WX110287-005 ; WUXIAPPTEC WX110287-001 ; WUXIAPPTEC WX110287-010 |
| MDL Number.: | MFCD17016537 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCC2OCCNC2(C)C1 |
| InChi: | InChI=1S/C13H24N2O3/c1-12(2,3)18-11(16)15-7-5-10-13(4,9-15)14-6-8-17-10/h10,14H,5-9H2,1-4H3 |
| InChiKey: | InChIKey=SMVQQYJIJQYOEK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.