* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FCHGROUP FCH925498 |
English Synonyms: | FCHGROUP FCH925498 |
MDL Number.: | MFCD17016538 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1CCC2C1OCCN2 |
InChi: | InChI=1S/C10H17NO3/c1-2-13-10(12)7-3-4-8-9(7)14-6-5-11-8/h7-9,11H,2-6H2,1H3 |
InChiKey: | InChIKey=CUJZSHIGIYJDIT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.