* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110291-001 |
| English Synonyms: | WUXIAPPTEC WX110291-005 ; WUXIAPPTEC WX110291-001 ; WUXIAPPTEC WX110291-010 |
| MDL Number.: | MFCD17016539 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1OCCC2NCCOC12 |
| InChi: | InChI=1S/C10H17NO4/c1-2-13-10(12)9-8-7(3-5-14-9)11-4-6-15-8/h7-9,11H,2-6H2,1H3 |
| InChiKey: | InChIKey=JAWUPRUTGJTKQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.