* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | WUXIAPPTEC WX110292-001 |
English Synonyms: | WUXIAPPTEC WX110292-010 ; WUXIAPPTEC WX110292-005 ; WUXIAPPTEC WX110292-001 |
MDL Number.: | MFCD17016540 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1COCC2NCCOC12 |
InChi: | InChI=1S/C10H17NO4/c1-2-14-10(12)7-5-13-6-8-9(7)15-4-3-11-8/h7-9,11H,2-6H2,1H3 |
InChiKey: | InChIKey=ODMMQFGAPSWHJG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.