* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110293-001 |
| English Synonyms: | WUXIAPPTEC WX110293-001 ; WUXIAPPTEC WX110293-010 ; WUXIAPPTEC WX110293-005 |
| MDL Number.: | MFCD17016541 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C1CC2NCCOC2CO1 |
| InChi: | InChI=1S/C10H17NO4/c1-2-13-10(12)8-5-7-9(6-15-8)14-4-3-11-7/h7-9,11H,2-6H2,1H3 |
| InChiKey: | InChIKey=NSBXVBPAJKAUKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.