* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115063-001 |
| English Synonyms: | WUXIAPPTEC WX115063-010 ; WUXIAPPTEC WX115063-005 ; WUXIAPPTEC WX115063-001 |
| MDL Number.: | MFCD17016558 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | OC(=O)[C@@H]1C[C@H]2NC3=CC=CC=C3[C@@H]12 |
| InChi: | InChI=1S/C11H11NO2/c13-11(14)7-5-9-10(7)6-3-1-2-4-8(6)12-9/h1-4,7,9-10,12H,5H2,(H,13,14)/t7-,9-,10+/m1/s1 |
| InChiKey: | InChIKey=SWCREMURFSOTAU-QNSHHTMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.