* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115067-001 |
| English Synonyms: | WUXIAPPTEC WX115067-001 ; WUXIAPPTEC WX115067-005 ; WUXIAPPTEC WX115067-010 |
| MDL Number.: | MFCD17016561 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]3CNC[C@@H]3C(F)(F)[C@H]2C1 |
| InChi: | InChI=1S/C14H22F2N2O2/c1-13(2,3)20-12(19)18-6-9-8-4-17-5-10(8)14(15,16)11(9)7-18/h8-11,17H,4-7H2,1-3H3/t8-,9-,10-,11-/m0/s1 |
| InChiKey: | InChIKey=ZEXDMCYXOSTERF-NAKRPEOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.