* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115069-001 |
| English Synonyms: | WUXIAPPTEC WX115069-005 ; WUXIAPPTEC WX115069-010 ; WUXIAPPTEC WX115069-001 |
| MDL Number.: | MFCD17016562 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCN2C(C1)C(N)CC1=CC=CC=C21 |
| InChi: | InChI=1S/C17H25N3O2/c1-17(2,3)22-16(21)19-8-9-20-14-7-5-4-6-12(14)10-13(18)15(20)11-19/h4-7,13,15H,8-11,18H2,1-3H3 |
| InChiKey: | InChIKey=YMFXOSLKUIVMNR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.