* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115070-001 |
| English Synonyms: | WUXIAPPTEC WX115070-001 ; WUXIAPPTEC WX115070-005 ; WUXIAPPTEC WX115070-010 |
| MDL Number.: | MFCD17016563 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CCN2C(C1)C(CC1=CC=CC=C21)C(O)=O |
| InChi: | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(23)19-8-9-20-14-7-5-4-6-12(14)10-13(16(21)22)15(20)11-19/h4-7,13,15H,8-11H2,1-3H3,(H,21,22) |
| InChiKey: | InChIKey=YHORCXIVAGMFBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.