* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115076-001 |
| English Synonyms: | WUXIAPPTEC WX115076-010 ; WUXIAPPTEC WX115076-005 ; WUXIAPPTEC WX115076-001 |
| MDL Number.: | MFCD17016569 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)OC(=O)N[C@]12CNC[C@H]1NC1=CC=CC=C21 |
| InChi: | InChI=1S/C15H21N3O2/c1-14(2,3)20-13(19)18-15-9-16-8-12(15)17-11-7-5-4-6-10(11)15/h4-7,12,16-17H,8-9H2,1-3H3,(H,18,19)/t12-,15+/m1/s1 |
| InChiKey: | InChIKey=USRPXBXPTDMTTI-DOMZBBRYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.