* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115078-001 |
| English Synonyms: | WUXIAPPTEC WX115078-001 ; WUXIAPPTEC WX115078-010 ; WUXIAPPTEC WX115078-005 |
| MDL Number.: | MFCD17016570 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | [H][C@@]12C[C@@H](CCN1C1=CC=CC=C1N(C2)C(=O)OC(C)(C)C)C(O)=O |
| InChi: | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(23)20-11-13-10-12(16(21)22)8-9-19(13)14-6-4-5-7-15(14)20/h4-7,12-13H,8-11H2,1-3H3,(H,21,22)/t12-,13+/m1/s1 |
| InChiKey: | InChIKey=NJGAUUTXSQXPJS-OLZOCXBDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.