* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX115081-001 |
| English Synonyms: | WUXIAPPTEC WX115081-001 ; WUXIAPPTEC WX115081-010 ; WUXIAPPTEC WX115081-005 |
| MDL Number.: | MFCD17016573 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1CC2NCCC2C2=C(C1)C=CC=C2 |
| InChi: | InChI=1S/C17H24N2O2/c1-17(2,3)21-16(20)19-10-12-6-4-5-7-13(12)14-8-9-18-15(14)11-19/h4-7,14-15,18H,8-11H2,1-3H3 |
| InChiKey: | InChIKey=LICBLERYMSBFOG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.